CAS 2589702-05-4 is the registry number for 3-Azathalidomide-piperazine. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(2,6-dioxopiperidin-3-yl)-2-piperazin-1-ylpyrrolo[3,4-b]pyridine-5,7-dione (CAS 2589702-05-4) is a chemical compound with the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. IUPAC name: 6-(2,6-dioxopiperidin-3-yl)-2-piperazin-1-ylpyrrolo[3,4-b]pyridine-5,7-dione. InChIKey: MDZHOFKQPFLFQE-UHFFFAOYSA-N.
| Molecular formula | C16H17N5O4 |
|---|---|
| Molecular weight | 343.34 g/mol |
| IUPAC name | 6-(2,6-dioxopiperidin-3-yl)-2-piperazin-1-ylpyrrolo[3,4-b]pyridine-5,7-dione |
| InChIKey | MDZHOFKQPFLFQE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)N=C(C=C3)N4CCNCC4 |
Computed by PubChem (NCBI)