Products 927822-45-5
CAS 927822-45-5 is the registry number for UC-1V150. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]benzaldehyde (CAS 927822-45-5) is a chemical compound with the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. IUPAC name: 4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]benzaldehyde. InChIKey: SHNIBVWXUOEWTA-UHFFFAOYSA-N.
| Molecular formula | C16H17N5O4 |
|---|---|
| Molecular weight | 343.34 g/mol |
| IUPAC name | 4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]benzaldehyde |
| InChIKey | SHNIBVWXUOEWTA-UHFFFAOYSA-N |
| SMILES | COCCOC1=NC(=C2C(=N1)N(C(=O)N2)CC3=CC=C(C=C3)C=O)N |
Computed by PubChem (NCBI)