CAS 259130-14-8 is the registry number for β-catenin-IN-8. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-chloro-N-(4-imidazol-1-ylphenyl)benzenesulfonamide (CAS 259130-14-8) is a chemical compound with the molecular formula C15H12ClN3O2S and a molecular weight of 333.8 g/mol. IUPAC name: 4-chloro-N-(4-imidazol-1-ylphenyl)benzenesulfonamide. InChIKey: KIQPGVHAKJPRNX-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN3O2S |
|---|---|
| Molecular weight | 333.8 g/mol |
| IUPAC name | 4-chloro-N-(4-imidazol-1-ylphenyl)benzenesulfonamide |
| InChIKey | KIQPGVHAKJPRNX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NS(=O)(=O)C2=CC=C(C=C2)Cl)N3C=CN=C3 |
Computed by PubChem (NCBI)