CAS 4029-40-7 is the registry number for N-(3-Chloroquinoxalin-2-yl)-2-methylbenzenesulfonamide, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-chloroquinoxalin-2-yl)-2-methylbenzenesulfonamide (CAS 4029-40-7) is a chemical compound with the molecular formula C15H12ClN3O2S and a molecular weight of 333.8 g/mol. IUPAC name: N-(3-chloroquinoxalin-2-yl)-2-methylbenzenesulfonamide. InChIKey: MAVFMTFLRILYNX-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN3O2S |
|---|---|
| Molecular weight | 333.8 g/mol |
| IUPAC name | N-(3-chloroquinoxalin-2-yl)-2-methylbenzenesulfonamide |
| InChIKey | MAVFMTFLRILYNX-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1S(=O)(=O)NC2=NC3=CC=CC=C3N=C2Cl |
Computed by PubChem (NCBI)