Products 259139-51-0
CAS 259139-51-0 appears in our catalog under these names: Bis(4-methylpentyl) Phthalate, >95% (HPLC), Phthalic acid, bis-4-methylpentyl ester, Bis(4-methylpentyl)phthalate. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, Sigma-Aldrich. Available pack sizes: 100mg, 10mg, 50mg, 250mg, 500mg, 1000mg, 2000mg.
Bis(4-methylpentyl) benzene-1,2-dicarboxylate (CAS 259139-51-0) is a chemical compound with the molecular formula C20H30O4 and a molecular weight of 334.4 g/mol. IUPAC name: bis(4-methylpentyl) benzene-1,2-dicarboxylate. InChIKey: ALEROMXYYSQFLX-UHFFFAOYSA-N.
| Molecular formula | C20H30O4 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | bis(4-methylpentyl) benzene-1,2-dicarboxylate |
| InChIKey | ALEROMXYYSQFLX-UHFFFAOYSA-N |
| SMILES | CC(C)CCCOC(=O)C1=CC=CC=C1C(=O)OCCCC(C)C |
Computed by PubChem (NCBI)
Synonyms:
DIISOHEXYL PHTHALATE, 1,2-Benzenedicarboxylic acid, diisohexyl ester, 1,2-Benzenedicarboxylic acid, bis(4-methylpentyl) ester, 1,2-Benzenedicarboxylic acid diisohexyl ester, diisohexyl benzene-1,2-dicarboxylate, Bis(4-methylpentyl) 1,2-benzenedicarboxylate, Phthalic acid diisohexyl ester, Phthalic acid di(4-methylpentyl) ester, Diisohexyl phthalic acid, 1,2-bis(4-methylpentyl) benzene-1,2-dicarboxylate