Products 71850-09-4
CAS 71850-09-4 appears in our catalog under these names: Diisohexyl Phthalate, Diisohexyl phthalate, Diisohexyl phthalate, 99.01% ,, 99.01% ,, Diisohexyl phthalate, 95.84%. Offered by: Chemat Brand, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 100mg, 25mg, 50mg, 200mg, 500mg, 50 mg, 100 mg.
Bis(4-methylpentyl) benzene-1,2-dicarboxylate (CAS 71850-09-4) is a chemical compound with the molecular formula C20H30O4 and a molecular weight of 334.4 g/mol. IUPAC name: bis(4-methylpentyl) benzene-1,2-dicarboxylate. InChIKey: ALEROMXYYSQFLX-UHFFFAOYSA-N.
| Molecular formula | C20H30O4 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | bis(4-methylpentyl) benzene-1,2-dicarboxylate |
| InChIKey | ALEROMXYYSQFLX-UHFFFAOYSA-N |
| SMILES | CC(C)CCCOC(=O)C1=CC=CC=C1C(=O)OCCCC(C)C |
Computed by PubChem (NCBI)
Synonyms:
DIISOHEXYL PHTHALATE, 1,2-Benzenedicarboxylic acid, diisohexyl ester, 1,2-Benzenedicarboxylic acid, bis(4-methylpentyl) ester, 1,2-Benzenedicarboxylic acid diisohexyl ester, diisohexyl benzene-1,2-dicarboxylate, Bis(4-methylpentyl) 1,2-benzenedicarboxylate, Phthalic acid diisohexyl ester, Phthalic acid di(4-methylpentyl) ester, Diisohexyl phthalic acid, 1,2-bis(4-methylpentyl) benzene-1,2-dicarboxylate