CAS 2595-39-3 is the registry number for Methyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyranoside. Offered by: Chemat. Available pack sizes: 10g, 1g, 2g, 5g.
[(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-methoxyoxan-2-yl]methyl acetate (CAS 2595-39-3) is a chemical compound with the molecular formula C15H23NO9 and a molecular weight of 361.34 g/mol. IUPAC name: [(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-methoxyoxan-2-yl]methyl acetate. InChIKey: BKJUFVXNIJMMKO-RYPNDVFKSA-N.
| Molecular formula | C15H23NO9 |
|---|---|
| Molecular weight | 361.34 g/mol |
| IUPAC name | [(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-methoxyoxan-2-yl]methyl acetate |
| InChIKey | BKJUFVXNIJMMKO-RYPNDVFKSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@@H]1OC)COC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)