CAS 54750-10-6 is the registry number for (-)-Isoproterenol (+)-Bitartrate Salt. Offered by: TRC. Available pack sizes: 500mg.
(2R,3R)-2,3-dihydroxybutanedioic acid;4-[(1R)-1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol (CAS 54750-10-6) is a chemical compound with the molecular formula C15H23NO9 and a molecular weight of 361.34 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;4-[(1R)-1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol. InChIKey: LBOPECYONBDFEM-MBANBULQSA-N.
| Molecular formula | C15H23NO9 |
|---|---|
| Molecular weight | 361.34 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;4-[(1R)-1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol |
| InChIKey | LBOPECYONBDFEM-MBANBULQSA-N |
| SMILES | CC(C)NC[C@@H](C1=CC(=C(C=C1)O)O)O.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)