Products 2595-46-2
CAS 2595-46-2 appears in our catalog under these names: Ethyl b-D-thioxylopyranoside, Ethyl 1-thio-β-D-xylopyranoside. Offered by: Biosynth, Chemat. Available pack sizes: 10g, 5g, 1g, 2g, 500mg, 25g, 50g.
(2S,3R,4S,5R)-2-ethylsulfanyloxane-3,4,5-triol (CAS 2595-46-2) is a chemical compound with the molecular formula C7H14O4S and a molecular weight of 194.25 g/mol. IUPAC name: (2S,3R,4S,5R)-2-ethylsulfanyloxane-3,4,5-triol. InChIKey: INHTVDLGULFITI-UCROKIRRSA-N.
| Molecular formula | C7H14O4S |
|---|---|
| Molecular weight | 194.25 g/mol |
| IUPAC name | (2S,3R,4S,5R)-2-ethylsulfanyloxane-3,4,5-triol |
| InChIKey | INHTVDLGULFITI-UCROKIRRSA-N |
| SMILES | CCS[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Ethyl b-D-thioxylopyranoside