CAS 259526-67-5 is the registry number for Ecgonidine Methyl Ester-d3. Offered by: TRC. Available pack sizes: 25mg.
Trideuteriomethyl (1R,5S)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate (CAS 259526-67-5) is a chemical compound with the molecular formula C10H15NO2 and a molecular weight of 184.25 g/mol. IUPAC name: trideuteriomethyl (1R,5S)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate. InChIKey: MPSNEAHFGOEKBI-CWYCHJBSSA-N.
| Molecular formula | C10H15NO2 |
|---|---|
| Molecular weight | 184.25 g/mol |
| IUPAC name | trideuteriomethyl (1R,5S)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate |
| InChIKey | MPSNEAHFGOEKBI-CWYCHJBSSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)C1=CC[C@@H]2CC[C@H]1N2C |
Computed by PubChem (NCBI)