CAS 737742-68-6 is the registry number for Ecgonidine-d3 Methyl Ester. Offered by: TRC. Available pack sizes: 5mg.
Methyl (1R,5S)-8-(trideuteriomethyl)-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate (CAS 737742-68-6) is a chemical compound with the molecular formula C10H15NO2 and a molecular weight of 184.25 g/mol. IUPAC name: methyl (1R,5S)-8-(trideuteriomethyl)-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate. InChIKey: MPSNEAHFGOEKBI-HCWRASKGSA-N.
| Molecular formula | C10H15NO2 |
|---|---|
| Molecular weight | 184.25 g/mol |
| IUPAC name | methyl (1R,5S)-8-(trideuteriomethyl)-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate |
| InChIKey | MPSNEAHFGOEKBI-HCWRASKGSA-N |
| SMILES | [2H]C([2H])([2H])N1[C@H]2CC[C@@H]1C(=CC2)C(=O)OC |
Computed by PubChem (NCBI)