Products 2597957-88-3
CAS 2597957-88-3 is the registry number for 2-(5-Aminopyridin-2-yl)-1,1,3,3-tetrafluoropropan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(5-amino-2-pyridinyl)-1,1,3,3-tetrafluoropropan-2-ol (CAS 2597957-88-3) is a chemical compound with the molecular formula C8H8F4N2O and a molecular weight of 224.16 g/mol. IUPAC name: 2-(5-amino-2-pyridinyl)-1,1,3,3-tetrafluoropropan-2-ol. InChIKey: JCPJRWYCYKIMJZ-UHFFFAOYSA-N.
| Molecular formula | C8H8F4N2O |
|---|---|
| Molecular weight | 224.16 g/mol |
| IUPAC name | 2-(5-amino-2-pyridinyl)-1,1,3,3-tetrafluoropropan-2-ol |
| InChIKey | JCPJRWYCYKIMJZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1N)C(C(F)F)(C(F)F)O |
Computed by PubChem (NCBI)