CAS 61988-37-2 appears in our catalog under these names: 4-(1,1,2,2-Tetrafluoro-ethoxy)-benzene-1,3-diamine, 95%, 4-(1,1,2,2-tetrafluoroethoxy)-3-benzenediamine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-(1,1,2,2-tetrafluoroethoxy)benzene-1,3-diamine (CAS 61988-37-2) is a chemical compound with the molecular formula C8H8F4N2O and a molecular weight of 224.16 g/mol. IUPAC name: 4-(1,1,2,2-tetrafluoroethoxy)benzene-1,3-diamine. InChIKey: GZBDTUVDCDMCDU-UHFFFAOYSA-N.
| Molecular formula | C8H8F4N2O |
|---|---|
| Molecular weight | 224.16 g/mol |
| IUPAC name | 4-(1,1,2,2-tetrafluoroethoxy)benzene-1,3-diamine |
| InChIKey | GZBDTUVDCDMCDU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)N)OC(C(F)F)(F)F |
Computed by PubChem (NCBI)