CAS 259809-44-4 appears in our catalog under these names: tert-Butyl 7,8-dihydro-1,6-naphthyridine-6(5h)-carboxylate, 95%, tert–Butyl 7，8–dihydro–1，6–naphthyridine–6(5H)–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Tert-butyl 7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate (CAS 259809-44-4) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: tert-butyl 7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate. InChIKey: QOYGREZOOLKXJB-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | tert-butyl 7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
| InChIKey | QOYGREZOOLKXJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C=CC=N2 |
Computed by PubChem (NCBI)