CAS 2599290-42-1 appears in our catalog under these names: 4-Bromo-6,7-difluoro-1H-indazole, 98%, 4-Bromo-6,7-difluoro-1H-indazole, 98%, 98%, 4-Bromo-6,7-difluoro-1H-indazole, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g, 50g, 100g.
4-bromo-6,7-difluoro-1H-indazole (CAS 2599290-42-1) is a chemical compound with the molecular formula C7H3BrF2N2 and a molecular weight of 233.01 g/mol. IUPAC name: 4-bromo-6,7-difluoro-1H-indazole. InChIKey: MARLLKXYZHPZPL-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2N2 |
|---|---|
| Molecular weight | 233.01 g/mol |
| IUPAC name | 4-bromo-6,7-difluoro-1H-indazole |
| InChIKey | MARLLKXYZHPZPL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C2C(=C1Br)C=NN2)F)F |
Computed by PubChem (NCBI)