Products 2639765-78-7
CAS 2639765-78-7 is the registry number for 3-Bromo-4,5-difluoro-1H-pyrrolo[2,3-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-4,5-difluoro-1H-pyrrolo[2,3-b]pyridine (CAS 2639765-78-7) is a chemical compound with the molecular formula C7H3BrF2N2 and a molecular weight of 233.01 g/mol. IUPAC name: 3-bromo-4,5-difluoro-1H-pyrrolo[2,3-b]pyridine. InChIKey: WRAUFWXQQNFXTA-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2N2 |
|---|---|
| Molecular weight | 233.01 g/mol |
| IUPAC name | 3-bromo-4,5-difluoro-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | WRAUFWXQQNFXTA-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C(=CN=C2N1)F)F)Br |
Computed by PubChem (NCBI)