Products 26017-03-8

CAS 26017-03-8 is the registry number for Fosfomycin Trometamol Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[(2S,3R)-3-methyloxiran-2-yl]phosphonic acid (CAS 26017-03-8) is a chemical compound with the molecular formula C3H7O4P and a molecular weight of 138.06 g/mol. IUPAC name: [(2S,3R)-3-methyloxiran-2-yl]phosphonic acid. InChIKey: YMDXZJFXQJVXBF-GBXIJSLDSA-N.

Identity
Molecular formulaC3H7O4P
Molecular weight138.06 g/mol
IUPAC name[(2S,3R)-3-methyloxiran-2-yl]phosphonic acid
InChIKeyYMDXZJFXQJVXBF-GBXIJSLDSA-N
SMILESC[C@@H]1[C@@H](O1)P(=O)(O)O

Computed by PubChem (NCBI)