CAS 26017-03-8 is the registry number for Fosfomycin Trometamol Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S,3R)-3-methyloxiran-2-yl]phosphonic acid (CAS 26017-03-8) is a chemical compound with the molecular formula C3H7O4P and a molecular weight of 138.06 g/mol. IUPAC name: [(2S,3R)-3-methyloxiran-2-yl]phosphonic acid. InChIKey: YMDXZJFXQJVXBF-GBXIJSLDSA-N.
| Molecular formula | C3H7O4P |
|---|---|
| Molecular weight | 138.06 g/mol |
| IUPAC name | [(2S,3R)-3-methyloxiran-2-yl]phosphonic acid |
| InChIKey | YMDXZJFXQJVXBF-GBXIJSLDSA-N |
| SMILES | C[C@@H]1[C@@H](O1)P(=O)(O)O |
Computed by PubChem (NCBI)