Products 45629-00-3
CAS 45629-00-3 appears in our catalog under these names: Fosfomycin Diastereomer 2, Fosfomycin Trometamol Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R)-3-methyloxiran-2-yl]phosphonic acid (CAS 45629-00-3) is a chemical compound with the molecular formula C3H7O4P and a molecular weight of 138.06 g/mol. IUPAC name: [(2R,3R)-3-methyloxiran-2-yl]phosphonic acid. InChIKey: YMDXZJFXQJVXBF-PWNYCUMCSA-N.
| Molecular formula | C3H7O4P |
|---|---|
| Molecular weight | 138.06 g/mol |
| IUPAC name | [(2R,3R)-3-methyloxiran-2-yl]phosphonic acid |
| InChIKey | YMDXZJFXQJVXBF-PWNYCUMCSA-N |
| SMILES | C[C@@H]1[C@H](O1)P(=O)(O)O |
Computed by PubChem (NCBI)
Synonyms:
Fosfomycin Diastereomer 2, ((2R,3R)-3-methyloxiran-2-yl)phosphonic acid, [(2R,3R)-3-Methyloxiran-2-yl]phosphonic acid, Fosfomycin Trometamol Impurity 10, Fosfomycin Trometamol Impurity 21, Fosfomycin Trometamol?Impurity 10, (2R,3R)-(3-Methyloxiranyl)phosphonic acid, (2R-trans)-(3-Methyloxiranyl)phosphonic acid, (3-Methyloxiranyl)phosphonic acid, (2R,3R)-, (3-Methyloxiranyl)phosphonic acid, (2R-trans)-