CAS 260273-82-3 appears in our catalog under these names: Paliperidone Impurity 1, 3-(2-Chloroethyl)-9-hydroxy-2-methyl-4H-pyrido(1,2-a)pyrimidin-4-one, >95% (HPLC), 3-(2-Chloroethyl)-9-hydroxy-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one, 97%. Offered by: Chemat Brand, TRC, Fluorochem. Available pack sizes: on request, 100mg, 10mg, 50mg, 250mg, 1g.
3-(2-chloroethyl)-9-hydroxy-2-methylpyrido[1,2-a]pyrimidin-4-one (CAS 260273-82-3) is a chemical compound with the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. IUPAC name: 3-(2-chloroethyl)-9-hydroxy-2-methylpyrido[1,2-a]pyrimidin-4-one. InChIKey: NMALKTKBJPTUDK-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O2 |
|---|---|
| Molecular weight | 238.67 g/mol |
| IUPAC name | 3-(2-chloroethyl)-9-hydroxy-2-methylpyrido[1,2-a]pyrimidin-4-one |
| InChIKey | NMALKTKBJPTUDK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N2C=CC=C(C2=N1)O)CCCl |
Computed by PubChem (NCBI)