CAS 260371-16-2 appears in our catalog under these names: Citalopram Impurity 31, 4-(4-Fluorobenzoyl)-3-hydroxymethylbenzonitrile, Citalopram Impurity 19. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
4-(4-fluorobenzoyl)-3-(hydroxymethyl)benzonitrile (CAS 260371-16-2) is a chemical compound with the molecular formula C15H10FNO2 and a molecular weight of 255.24 g/mol. IUPAC name: 4-(4-fluorobenzoyl)-3-(hydroxymethyl)benzonitrile. InChIKey: GDOCLIOVHKLEOU-UHFFFAOYSA-N.
| Molecular formula | C15H10FNO2 |
|---|---|
| Molecular weight | 255.24 g/mol |
| IUPAC name | 4-(4-fluorobenzoyl)-3-(hydroxymethyl)benzonitrile |
| InChIKey | GDOCLIOVHKLEOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(C=C(C=C2)C#N)CO)F |
Computed by PubChem (NCBI)