CAS 260392-48-1 is the registry number for 1-(Chloroacetyl)-4-[3-(trifluoromethyl)pyridin-2-yl]piperazine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
2-chloro-1-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethanone (CAS 260392-48-1) is a chemical compound with the molecular formula C12H13ClF3N3O and a molecular weight of 307.70 g/mol. IUPAC name: 2-chloro-1-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethanone. InChIKey: VJWFPTMUUFXFOU-UHFFFAOYSA-N.
| Molecular formula | C12H13ClF3N3O |
|---|---|
| Molecular weight | 307.70 g/mol |
| IUPAC name | 2-chloro-1-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethanone |
| InChIKey | VJWFPTMUUFXFOU-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=C(C=CC=N2)C(F)(F)F)C(=O)CCl |
Computed by PubChem (NCBI)