CAS 338780-66-8 is the registry number for 1-(3-Chloro-5-trifluoromethyl)-2-pyridyl-4-piperidinecarboxamide. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide (CAS 338780-66-8) is a chemical compound with the molecular formula C12H13ClF3N3O and a molecular weight of 307.70 g/mol. IUPAC name: 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide. InChIKey: PMZLEJZBYZVZMY-UHFFFAOYSA-N.
| Molecular formula | C12H13ClF3N3O |
|---|---|
| Molecular weight | 307.70 g/mol |
| IUPAC name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide |
| InChIKey | PMZLEJZBYZVZMY-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)N)C2=C(C=C(C=N2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)