CAS 260450-77-9 appears in our catalog under these names: Fmoc-l-glutaminol, 98%, (9H-Fluoren-9-yl)methyl (S)-(5-amino-1-hydroxy-5-oxopentan-2-yl)carbamate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 25g.
9H-fluoren-9-ylmethyl N-[(2S)-5-amino-1-hydroxy-5-oxopentan-2-yl]carbamate (CAS 260450-77-9) is a chemical compound with the molecular formula C20H22N2O4 and a molecular weight of 354.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(2S)-5-amino-1-hydroxy-5-oxopentan-2-yl]carbamate. InChIKey: YEFBQRPCTZMXRU-ZDUSSCGKSA-N.
| Molecular formula | C20H22N2O4 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(2S)-5-amino-1-hydroxy-5-oxopentan-2-yl]carbamate |
| InChIKey | YEFBQRPCTZMXRU-ZDUSSCGKSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCC(=O)N)CO |
Computed by PubChem (NCBI)