CAS 400746-61-4 is the registry number for (R)-5-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-aminopentanoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-amino-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 400746-61-4) is a chemical compound with the molecular formula C20H22N2O4 and a molecular weight of 354.4 g/mol. IUPAC name: (2R)-2-amino-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: UZQSWMYLYLRAMJ-GOSISDBHSA-N.
| Molecular formula | C20H22N2O4 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (2R)-2-amino-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | UZQSWMYLYLRAMJ-GOSISDBHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCC[C@H](C(=O)O)N |
Computed by PubChem (NCBI)