CAS 2609867-52-7 is the registry number for 4,4,5,5-Tetramethyl-2-(4-phenylbicyclo[2.1.1]hexan-1-yl)-1,3,2-dioxaborolane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,4,5,5-tetramethyl-2-(4-phenyl-1-bicyclo[2.1.1]hexanyl)-1,3,2-dioxaborolane (CAS 2609867-52-7) is a chemical compound with the molecular formula C18H25BO2 and a molecular weight of 284.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-phenyl-1-bicyclo[2.1.1]hexanyl)-1,3,2-dioxaborolane. InChIKey: DVJSCIVFTPUGCN-UHFFFAOYSA-N.
| Molecular formula | C18H25BO2 |
|---|---|
| Molecular weight | 284.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-phenyl-1-bicyclo[2.1.1]hexanyl)-1,3,2-dioxaborolane |
| InChIKey | DVJSCIVFTPUGCN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C23CCC(C2)(C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)