CAS 462636-88-0 is the registry number for 4,4,5,5-Tetramethyl-2-(2-phenyl-1-cyclohexen-1-yl)-1,3,2-dioxaborolane. Offered by: TRC. Available pack sizes: 2,5g.
4,4,5,5-tetramethyl-2-(2-phenylcyclohexen-1-yl)-1,3,2-dioxaborolane (CAS 462636-88-0) is a chemical compound with the molecular formula C18H25BO2 and a molecular weight of 284.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-phenylcyclohexen-1-yl)-1,3,2-dioxaborolane. InChIKey: MUIKZTUXJAVHEE-UHFFFAOYSA-N.
| Molecular formula | C18H25BO2 |
|---|---|
| Molecular weight | 284.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-phenylcyclohexen-1-yl)-1,3,2-dioxaborolane |
| InChIKey | MUIKZTUXJAVHEE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(CCCC2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)