CAS 261-43-8 is the registry number for Pyrazino[2,3-g]quinoxaline, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
Pyrazino[2,3-g]quinoxaline (CAS 261-43-8) is a chemical compound with the molecular formula C10H6N4 and a molecular weight of 182.18 g/mol. IUPAC name: pyrazino[2,3-g]quinoxaline. InChIKey: RAHGMXOHVFGEDR-UHFFFAOYSA-N.
| Molecular formula | C10H6N4 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | pyrazino[2,3-g]quinoxaline |
| InChIKey | RAHGMXOHVFGEDR-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C=C3C(=CC2=N1)N=CC=N3 |
Computed by PubChem (NCBI)