Products 261179-09-3

CAS 261179-09-3 is the registry number for FA-Met-OH. Offered by: Creative Peptides, Biosynth. Available pack sizes: 1g, 5g, 5000mg, 2000mg, 10000mg.

Structural formula: {0} (CAS {1})

(2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid (CAS 261179-09-3) is a chemical compound with the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. IUPAC name: (2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid. InChIKey: KHFWWYXHMBWCPB-YEZKRMTDSA-N.

Identity
Molecular formulaC12H15NO4S
Molecular weight269.32 g/mol
IUPAC name(2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid
InChIKeyKHFWWYXHMBWCPB-YEZKRMTDSA-N
SMILESCSCC[C@@H](C(=O)O)NC(=O)/C=C/C1=CC=CO1

Computed by PubChem (NCBI)