CAS 261179-09-3 is the registry number for FA-Met-OH. Offered by: Creative Peptides, Biosynth. Available pack sizes: 1g, 5g, 5000mg, 2000mg, 10000mg.
(2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid (CAS 261179-09-3) is a chemical compound with the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. IUPAC name: (2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid. InChIKey: KHFWWYXHMBWCPB-YEZKRMTDSA-N.
| Molecular formula | C12H15NO4S |
|---|---|
| Molecular weight | 269.32 g/mol |
| IUPAC name | (2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid |
| InChIKey | KHFWWYXHMBWCPB-YEZKRMTDSA-N |
| SMILES | CSCC[C@@H](C(=O)O)NC(=O)/C=C/C1=CC=CO1 |
Computed by PubChem (NCBI)