CAS 2613-26-5 appears in our catalog under these names: 3-Nitrophenylsulfur pentafluoride, 96%, 3–Nitrophenylsulfur Pentafluoride, 3-Nitrophenylsulfur Pentafluoride, >96.0%(GC), 3-Nitrophenylsulfur Pentafluoride, 97%, 97%, 3-Nitrophenylsulfur pentafluoride, 95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg, 100mg, 10g.
Pentafluoro-(3-nitrophenyl)-lambda6-sulfane (CAS 2613-26-5) is a chemical compound with the molecular formula C6H4F5NO2S and a molecular weight of 249.16 g/mol. IUPAC name: pentafluoro-(3-nitrophenyl)-lambda6-sulfane. InChIKey: FSTNQYCPXJMFMT-UHFFFAOYSA-N.
| Molecular formula | C6H4F5NO2S |
|---|---|
| Molecular weight | 249.16 g/mol |
| IUPAC name | pentafluoro-(3-nitrophenyl)-lambda6-sulfane |
| InChIKey | FSTNQYCPXJMFMT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(F)(F)(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)