CAS 2613-27-6 appears in our catalog under these names: (Oc-6-21)-Pentafluoro(4-Nitrophenyl)-Sulfur, 4-Nitrophenylsulfur pentafluoride, 96%, 4–Nitrophenylsulfur Pentafluoride, 4-Nitrophenylsulfur Pentafluoride, >96.0%(GC), 4-Nitrophenylsulfur pentafluoride, 97%, 97%. Offered by: Biosynth, Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 25g.
Pentafluoro-(4-nitrophenyl)-lambda6-sulfane (CAS 2613-27-6) is a chemical compound with the molecular formula C6H4F5NO2S and a molecular weight of 249.16 g/mol. IUPAC name: pentafluoro-(4-nitrophenyl)-lambda6-sulfane. InChIKey: AGNCKMHGYZKMLN-UHFFFAOYSA-N.
| Molecular formula | C6H4F5NO2S |
|---|---|
| Molecular weight | 249.16 g/mol |
| IUPAC name | pentafluoro-(4-nitrophenyl)-lambda6-sulfane |
| InChIKey | AGNCKMHGYZKMLN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])S(F)(F)(F)(F)F |
Computed by PubChem (NCBI)