CAS 261349-38-6 is the registry number for 3-(5-(tert-Butyl)-1,3,4-oxadiazol-2-yl)aniline, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-(5-tert-butyl-1,3,4-oxadiazol-2-yl)aniline (CAS 261349-38-6) is a chemical compound with the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. IUPAC name: 3-(5-tert-butyl-1,3,4-oxadiazol-2-yl)aniline. InChIKey: KZVYJIALRIHGLZ-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O |
|---|---|
| Molecular weight | 217.27 g/mol |
| IUPAC name | 3-(5-tert-butyl-1,3,4-oxadiazol-2-yl)aniline |
| InChIKey | KZVYJIALRIHGLZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN=C(O1)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)