CAS 26155-31-7 appears in our catalog under these names: Morantel L-Tartrate, Morantel Tartrate, >95% (HPLC), Morantel tartrate, 98+%, Morantel tartrate, Morantel tartrate/ 99.86% (existing batch purity). Offered by: Chemat Brand, TRC, AmBeed, Dr. Ehrenstorfer, TargetMol. Available pack sizes: on request, 100mg, 1g, 250mg, 5mg, 10mg, 25mg, 50mg.
(2R,3R)-2,3-dihydroxybutanedioic acid;1-methyl-2-[(E)-2-(3-methylthiophen-2-yl)ethenyl]-5,6-dihydro-4H-pyrimidine (CAS 26155-31-7) is a chemical compound with the molecular formula C16H22N2O6S and a molecular weight of 370.4 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;1-methyl-2-[(E)-2-(3-methylthiophen-2-yl)ethenyl]-5,6-dihydro-4H-pyrimidine. InChIKey: GGXQONWGCAQGNA-UUSVNAAPSA-N.
| Molecular formula | C16H22N2O6S |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;1-methyl-2-[(E)-2-(3-methylthiophen-2-yl)ethenyl]-5,6-dihydro-4H-pyrimidine |
| InChIKey | GGXQONWGCAQGNA-UUSVNAAPSA-N |
| SMILES | CC1=C(SC=C1)/C=C/C2=NCCCN2C.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)