CAS 874838-79-6 appears in our catalog under these names: 3-(4-(tert-Butoxycarbonyl)piperazin-1-ylsulfonyl)benzoic acid, 95%, 3-(4-BOC-PIPERAZIN-1-YLSULFONYL)BENZOIC ACID, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
3-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]sulfonylbenzoic acid (CAS 874838-79-6) is a chemical compound with the molecular formula C16H22N2O6S and a molecular weight of 370.4 g/mol. IUPAC name: 3-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]sulfonylbenzoic acid. InChIKey: NEONUMCAWBLQLU-UHFFFAOYSA-N.
| Molecular formula | C16H22N2O6S |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | 3-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]sulfonylbenzoic acid |
| InChIKey | NEONUMCAWBLQLU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)S(=O)(=O)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)