CAS 2616540-83-9 appears in our catalog under these names: 2-(2,6-Dioxopiperidin-3-yl)-6,7-dihydropyrrolo[3,4-f]isoindole-1,3(2H,5H)-dione, 98%, Thalidomide-pyrrolidine. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
2-(2,6-dioxopiperidin-3-yl)-6,7-dihydro-5H-pyrrolo[3,4-f]isoindole-1,3-dione (CAS 2616540-83-9) is a chemical compound with the molecular formula C15H13N3O4 and a molecular weight of 299.28 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-6,7-dihydro-5H-pyrrolo[3,4-f]isoindole-1,3-dione. InChIKey: DFRCTMCXNOBCLU-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O4 |
|---|---|
| Molecular weight | 299.28 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-6,7-dihydro-5H-pyrrolo[3,4-f]isoindole-1,3-dione |
| InChIKey | DFRCTMCXNOBCLU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C4CNCC4=C3 |
Computed by PubChem (NCBI)