CAS 864232-51-9 is the registry number for 1-(4-Nitrophenyl)ethan-1-one O-phenylcarbamoyl Oxime. Offered by: TRC. Available pack sizes: 50mg.
[(E)-1-(4-nitrophenyl)ethylideneamino] N-phenylcarbamate (CAS 864232-51-9) is a chemical compound with the molecular formula C15H13N3O4 and a molecular weight of 299.28 g/mol. IUPAC name: [(E)-1-(4-nitrophenyl)ethylideneamino] N-phenylcarbamate. InChIKey: DHEFCNDMOIOJBP-GZTJUZNOSA-N.
| Molecular formula | C15H13N3O4 |
|---|---|
| Molecular weight | 299.28 g/mol |
| IUPAC name | [(E)-1-(4-nitrophenyl)ethylideneamino] N-phenylcarbamate |
| InChIKey | DHEFCNDMOIOJBP-GZTJUZNOSA-N |
| SMILES | C/C(=N\OC(=O)NC1=CC=CC=C1)/C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)