CAS 26171-04-0 appears in our catalog under these names: Amisulpride Impurity 5, Sulpiride Impurity 5, Sulpiride Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.
(2Z)-1-ethyl-2-(nitromethylidene)pyrrolidine (CAS 26171-04-0) is a chemical compound with the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. IUPAC name: (2Z)-1-ethyl-2-(nitromethylidene)pyrrolidine. InChIKey: MSXAUUYIGJZVTR-SREVYHEPSA-N.
| Molecular formula | C7H12N2O2 |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | (2Z)-1-ethyl-2-(nitromethylidene)pyrrolidine |
| InChIKey | MSXAUUYIGJZVTR-SREVYHEPSA-N |
| SMILES | CCN\1CCC/C1=C/[N+](=O)[O-] |
Computed by PubChem (NCBI)