CAS 2619-37-6 is the registry number for 2,3,5,6-Tetramethylterephthalonitrile, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3,5,6-tetramethylbenzene-1,4-dicarbonitrile (CAS 2619-37-6) is a chemical compound with the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. IUPAC name: 2,3,5,6-tetramethylbenzene-1,4-dicarbonitrile. InChIKey: QXZOTYQXMMTSQB-UHFFFAOYSA-N.
| Molecular formula | C12H12N2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | 2,3,5,6-tetramethylbenzene-1,4-dicarbonitrile |
| InChIKey | QXZOTYQXMMTSQB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C#N)C)C)C#N)C |
Computed by PubChem (NCBI)