CAS 261924-51-0 is the registry number for 3-(Methanesulfonylmethyl)benzonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
3-(methylsulfonylmethyl)benzonitrile (CAS 261924-51-0) is a chemical compound with the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. IUPAC name: 3-(methylsulfonylmethyl)benzonitrile. InChIKey: BOOPGNSXYSIGKU-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2S |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | 3-(methylsulfonylmethyl)benzonitrile |
| InChIKey | BOOPGNSXYSIGKU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1=CC(=CC=C1)C#N |
Computed by PubChem (NCBI)