Products 2619651-57-7
CAS 2619651-57-7 is the registry number for Olaparib Impurity 45. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(3-oxo-1,2-dihydroindazol-5-yl)methyl]-2H-phthalazin-1-one (CAS 2619651-57-7) is a chemical compound with the molecular formula C16H12N4O2 and a molecular weight of 292.29 g/mol. IUPAC name: 4-[(3-oxo-1,2-dihydroindazol-5-yl)methyl]-2H-phthalazin-1-one. InChIKey: PBUGPUGMOKVFFO-UHFFFAOYSA-N.
| Molecular formula | C16H12N4O2 |
|---|---|
| Molecular weight | 292.29 g/mol |
| IUPAC name | 4-[(3-oxo-1,2-dihydroindazol-5-yl)methyl]-2H-phthalazin-1-one |
| InChIKey | PBUGPUGMOKVFFO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NNC2=O)CC3=CC4=C(C=C3)NNC4=O |
Computed by PubChem (NCBI)