CAS 6872-03-3 is the registry number for 6,6'-Diaminoindigotin. Offered by: TRC. Available pack sizes: 250mg.
6-amino-2-(6-amino-3-hydroxy-1H-indol-2-yl)indol-3-one (CAS 6872-03-3) is a chemical compound with the molecular formula C16H12N4O2 and a molecular weight of 292.29 g/mol. IUPAC name: 6-amino-2-(6-amino-3-hydroxy-1H-indol-2-yl)indol-3-one. InChIKey: QEMDTVKIMCJZJB-UHFFFAOYSA-N.
| Molecular formula | C16H12N4O2 |
|---|---|
| Molecular weight | 292.29 g/mol |
| IUPAC name | 6-amino-2-(6-amino-3-hydroxy-1H-indol-2-yl)indol-3-one |
| InChIKey | QEMDTVKIMCJZJB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)NC(=C2O)C3=NC4=C(C3=O)C=CC(=C4)N |
Computed by PubChem (NCBI)