Products 26204-18-2
CAS 26204-18-2 is the registry number for p-Xylene-alpha,alpha,alpha-d3, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
1-methyl-4-(trideuteriomethyl)benzene (CAS 26204-18-2) is a chemical compound with the molecular formula C8H10 and a molecular weight of 109.18 g/mol. IUPAC name: 1-methyl-4-(trideuteriomethyl)benzene. InChIKey: URLKBWYHVLBVBO-FIBGUPNXSA-N.
| Molecular formula | C8H10 |
|---|---|
| Molecular weight | 109.18 g/mol |
| IUPAC name | 1-methyl-4-(trideuteriomethyl)benzene |
| InChIKey | URLKBWYHVLBVBO-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)