CAS 56004-61-6 appears in our catalog under these names: O-Xylene-d10, 95%, o-Xylene D10, o-Xylene-d10 (Reagent grade), 99 atom % D, min 98% Chemical Purity, o–Xylene–d10, o-Xylene-d{10}, 98+% (Isotopic) . Offered by: Combi-blocks, Dr. Ehrenstorfer, CDN, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 5g, 50mg, 1g, 1x50mg.
1,2,3,4-tetradeuterio-5,6-bis(trideuteriomethyl)benzene (CAS 56004-61-6) is a chemical compound with the molecular formula C8H10 and a molecular weight of 116.23 g/mol. IUPAC name: 1,2,3,4-tetradeuterio-5,6-bis(trideuteriomethyl)benzene. InChIKey: CTQNGGLPUBDAKN-ZGYYUIRESA-N.
| Molecular formula | C8H10 |
|---|---|
| Molecular weight | 116.23 g/mol |
| IUPAC name | 1,2,3,4-tetradeuterio-5,6-bis(trideuteriomethyl)benzene |
| InChIKey | CTQNGGLPUBDAKN-ZGYYUIRESA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])[2H])C([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)