CAS 2621935-59-7 is the registry number for 3-(8-Bromonaphthalen-1-yl)propan-1-ol, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
3-(8-bromonaphthalen-1-yl)propan-1-ol (CAS 2621935-59-7) is a chemical compound with the molecular formula C13H13BrO and a molecular weight of 265.14 g/mol. IUPAC name: 3-(8-bromonaphthalen-1-yl)propan-1-ol. InChIKey: FJJZCUPXCSKTPA-UHFFFAOYSA-N.
| Molecular formula | C13H13BrO |
|---|---|
| Molecular weight | 265.14 g/mol |
| IUPAC name | 3-(8-bromonaphthalen-1-yl)propan-1-ol |
| InChIKey | FJJZCUPXCSKTPA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)CCCO)C(=CC=C2)Br |
Computed by PubChem (NCBI)