CAS 362657-66-7 appears in our catalog under these names: 5-Bromotricyclo(8.2.1.0,3,8)trideca-3,5,7-trien-13-one, 95%, 5-Bromotricyclo(8.2.1.0,3,8)trideca-3,5,7-trien-13-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-bromotricyclo[8.2.1.03,8]trideca-3(8),4,6-trien-13-one (CAS 362657-66-7) is a chemical compound with the molecular formula C13H13BrO and a molecular weight of 265.14 g/mol. IUPAC name: 5-bromotricyclo[8.2.1.03,8]trideca-3(8),4,6-trien-13-one. InChIKey: NSDVBODNBFCXBO-UHFFFAOYSA-N.
| Molecular formula | C13H13BrO |
|---|---|
| Molecular weight | 265.14 g/mol |
| IUPAC name | 5-bromotricyclo[8.2.1.03,8]trideca-3(8),4,6-trien-13-one |
| InChIKey | NSDVBODNBFCXBO-UHFFFAOYSA-N |
| SMILES | C1CC2CC3=C(CC1C2=O)C=CC(=C3)Br |
Computed by PubChem (NCBI)