Products 2623103-21-7

CAS 2623103-21-7 is the registry number for 3-(2,6-Dioxopiperidin-3-yl)benzofuran-5-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(2,6-dioxopiperidin-3-yl)-1-benzofuran-5-sulfonyl chloride (CAS 2623103-21-7) is a chemical compound with the molecular formula C13H10ClNO5S and a molecular weight of 327.74 g/mol. IUPAC name: 3-(2,6-dioxopiperidin-3-yl)-1-benzofuran-5-sulfonyl chloride. InChIKey: QWNAPDPCGCFPJX-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10ClNO5S
Molecular weight327.74 g/mol
IUPAC name3-(2,6-dioxopiperidin-3-yl)-1-benzofuran-5-sulfonyl chloride
InChIKeyQWNAPDPCGCFPJX-UHFFFAOYSA-N
SMILESC1CC(=O)NC(=O)C1C2=COC3=C2C=C(C=C3)S(=O)(=O)Cl

Computed by PubChem (NCBI)