Products 62547-10-8

CAS 62547-10-8 is the registry number for Sulpiride Impurity 13. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

5-[(3-chlorophenyl)sulfamoyl]-2-hydroxybenzoic acid (CAS 62547-10-8) is a chemical compound with the molecular formula C13H10ClNO5S and a molecular weight of 327.74 g/mol. IUPAC name: 5-[(3-chlorophenyl)sulfamoyl]-2-hydroxybenzoic acid. InChIKey: RTSVWWCADLZNGQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10ClNO5S
Molecular weight327.74 g/mol
IUPAC name5-[(3-chlorophenyl)sulfamoyl]-2-hydroxybenzoic acid
InChIKeyRTSVWWCADLZNGQ-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)Cl)NS(=O)(=O)C2=CC(=C(C=C2)O)C(=O)O

Computed by PubChem (NCBI)