CAS 2624138-03-8 is the registry number for 1-(2-bromo-6-chlorophenyl)methanamine hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2-bromo-6-chlorophenyl)methanamine;hydrochloride (CAS 2624138-03-8) is a chemical compound with the molecular formula C7H8BrCl2N and a molecular weight of 256.95 g/mol. IUPAC name: (2-bromo-6-chlorophenyl)methanamine;hydrochloride. InChIKey: CCCINWDSQHQGGB-UHFFFAOYSA-N.
| Molecular formula | C7H8BrCl2N |
|---|---|
| Molecular weight | 256.95 g/mol |
| IUPAC name | (2-bromo-6-chlorophenyl)methanamine;hydrochloride |
| InChIKey | CCCINWDSQHQGGB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)CN)Cl.Cl |
Computed by PubChem (NCBI)