CAS 2734041-80-4 appears in our catalog under these names: (3-Bromo-2-chlorophenyl)methanamine hydrochloride, 95%, (3-Bromo-2-chlorophenyl)methanamine hydrochloride, 98%, 98%, (3-Bromo-2-chlorophenyl)methanamine hydrochloride, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(3-bromo-2-chlorophenyl)methanamine;hydrochloride (CAS 2734041-80-4) is a chemical compound with the molecular formula C7H8BrCl2N and a molecular weight of 256.95 g/mol. IUPAC name: (3-bromo-2-chlorophenyl)methanamine;hydrochloride. InChIKey: HJASBSSWPABARC-UHFFFAOYSA-N.
| Molecular formula | C7H8BrCl2N |
|---|---|
| Molecular weight | 256.95 g/mol |
| IUPAC name | (3-bromo-2-chlorophenyl)methanamine;hydrochloride |
| InChIKey | HJASBSSWPABARC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)Cl)CN.Cl |
Computed by PubChem (NCBI)