Products 2624378-54-5
CAS 2624378-54-5 appears in our catalog under these names: (3S,4R)-1-(TERT-BUTOXYCARBONYL)-4-METHYLPYRROLIDINE-3-CARBOXYLIC ACID, 95%, 95%, (3S,4R)-1-(tert-Butoxycarbonyl)-4-methylpyrrolidine-3-carboxylic acid, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 1g.
(3S,4R)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 2624378-54-5) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: (3S,4R)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: IPLCSDCAWNDONJ-JGVFFNPUSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (3S,4R)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | IPLCSDCAWNDONJ-JGVFFNPUSA-N |
| SMILES | C[C@H]1CN(C[C@H]1C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)