Products 2627156-73-2
CAS 2627156-73-2 appears in our catalog under these names: 4-(Pyridin-4-ylethynyl)-1-naphthoic acid 95%, 4-(Pyridin-4-ylethynyl)-1-naphthoic acid, 95%, 95%, 4-(Pyridin-4-ylethynyl)-1-naphthoic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-(2-pyridin-4-ylethynyl)naphthalene-1-carboxylic acid (CAS 2627156-73-2) is a chemical compound with the molecular formula C18H11NO2 and a molecular weight of 273.3 g/mol. IUPAC name: 4-(2-pyridin-4-ylethynyl)naphthalene-1-carboxylic acid. InChIKey: YASKEXLSRIQFNI-UHFFFAOYSA-N.
| Molecular formula | C18H11NO2 |
|---|---|
| Molecular weight | 273.3 g/mol |
| IUPAC name | 4-(2-pyridin-4-ylethynyl)naphthalene-1-carboxylic acid |
| InChIKey | YASKEXLSRIQFNI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2C(=O)O)C#CC3=CC=NC=C3 |
Computed by PubChem (NCBI)